CAS 1258652-16-2 appears in our catalog under these names: 2-((3,5-Dimethylphenyl)amino)-N-phenylacetamide hydrochloride, 2-((3,5-Dimethylphenyl)amino)-N-phenylacetamide hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
2-(3,5-dimethylanilino)-N-phenylacetamide;hydrochloride (CAS 1258652-16-2) is a chemical compound with the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. IUPAC name: 2-(3,5-dimethylanilino)-N-phenylacetamide;hydrochloride. InChIKey: RELTWIRILQPOGD-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2O |
|---|---|
| Molecular weight | 290.79 g/mol |
| IUPAC name | 2-(3,5-dimethylanilino)-N-phenylacetamide;hydrochloride |
| InChIKey | RELTWIRILQPOGD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NCC(=O)NC2=CC=CC=C2)C.Cl |
Computed by PubChem (NCBI)