CAS 1258652-34-4 is the registry number for 1-(Trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-5-amine (CAS 1258652-34-4) is a chemical compound with the molecular formula C10H11F3N2 and a molecular weight of 216.20 g/mol. IUPAC name: 1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-5-amine. InChIKey: PUSXLLMFSROTFL-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-5-amine |
| InChIKey | PUSXLLMFSROTFL-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C(=CC=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)