CAS 2271054-19-2 is the registry number for 3,3-Dimethyl-5-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-5-(trifluoromethyl)-1,2-dihydropyrrolo[3,2-b]pyridine (CAS 2271054-19-2) is a chemical compound with the molecular formula C10H11F3N2 and a molecular weight of 216.20 g/mol. IUPAC name: 3,3-dimethyl-5-(trifluoromethyl)-1,2-dihydropyrrolo[3,2-b]pyridine. InChIKey: GLJSQBDWMKFITI-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 3,3-dimethyl-5-(trifluoromethyl)-1,2-dihydropyrrolo[3,2-b]pyridine |
| InChIKey | GLJSQBDWMKFITI-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C1N=C(C=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)