Products 2229302-59-2
CAS 2229302-59-2 is the registry number for (3,3-Difluoro-1-(3-fluoropyridin-2-yl)cyclobutyl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3,3-difluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methanamine (CAS 2229302-59-2) is a chemical compound with the molecular formula C10H11F3N2 and a molecular weight of 216.20 g/mol. IUPAC name: [3,3-difluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methanamine. InChIKey: QYQFVCIQXPCSCC-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | [3,3-difluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methanamine |
| InChIKey | QYQFVCIQXPCSCC-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)(CN)C2=C(C=CC=N2)F |
Computed by PubChem (NCBI)