CAS 2044796-78-1 appears in our catalog under these names: 6-(Trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-amine, 95%, 6-(Trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-amine (CAS 2044796-78-1) is a chemical compound with the molecular formula C10H11F3N2 and a molecular weight of 216.20 g/mol. IUPAC name: 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-amine. InChIKey: GPBKJDSUDBSMPM-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-8-amine |
| InChIKey | GPBKJDSUDBSMPM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)C(F)(F)F)N)NC1 |
Computed by PubChem (NCBI)