Products 1259298-01-5
CAS 1259298-01-5 is the registry number for 5-(4-(((tert-Butoxy)carbonyl)amino)phenyl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,2-oxazole-3-carboxylic acid (CAS 1259298-01-5) is a chemical compound with the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. IUPAC name: 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,2-oxazole-3-carboxylic acid. InChIKey: JQZDYOJZRRPROQ-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O5 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,2-oxazole-3-carboxylic acid |
| InChIKey | JQZDYOJZRRPROQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)