CAS 1259830-92-6 is the registry number for (S)-4-Bromo-5-fluoro-2,3-dihydro-1H-inden-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-amine (CAS 1259830-92-6) is a chemical compound with the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. IUPAC name: (1S)-4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: VKHLAHONTVDNNH-QMMMGPOBSA-N.
| Molecular formula | C9H9BrFN |
|---|---|
| Molecular weight | 230.08 g/mol |
| IUPAC name | (1S)-4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | VKHLAHONTVDNNH-QMMMGPOBSA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC(=C2Br)F |
Computed by PubChem (NCBI)