CAS 1259929-68-4 appears in our catalog under these names: 2-(Trifluoromethyl)-6-vinylpyridine hydrochloride, 95%, 2-(Trifluoromethyl)-6-vinylpyridine, 98% (stabilized with TBC). Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-ethenyl-6-(trifluoromethyl)pyridine;hydrochloride (CAS 1259929-68-4) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 2-ethenyl-6-(trifluoromethyl)pyridine;hydrochloride. InChIKey: KANBRSHCESCDJC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 2-ethenyl-6-(trifluoromethyl)pyridine;hydrochloride |
| InChIKey | KANBRSHCESCDJC-UHFFFAOYSA-N |
| SMILES | C=CC1=NC(=CC=C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)