Products 125995-17-7

CAS 125995-17-7 is the registry number for Atorvastatin Impurity 105. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (CAS 125995-17-7) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 2-[(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid. InChIKey: BNGGGQKEDABCQY-HTQZYQBOSA-N.

Identity
Molecular formulaC10H19NO4
Molecular weight217.26 g/mol
IUPAC name2-[(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid
InChIKeyBNGGGQKEDABCQY-HTQZYQBOSA-N
SMILESCC1(O[C@@H](C[C@@H](O1)CC(=O)O)CCN)C

Computed by PubChem (NCBI)