CAS 125995-17-7 is the registry number for Atorvastatin Impurity 105. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (CAS 125995-17-7) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 2-[(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid. InChIKey: BNGGGQKEDABCQY-HTQZYQBOSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-[(4R,6R)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
| InChIKey | BNGGGQKEDABCQY-HTQZYQBOSA-N |
| SMILES | CC1(O[C@@H](C[C@@H](O1)CC(=O)O)CCN)C |
Computed by PubChem (NCBI)