CAS 2165770-84-1 appears in our catalog under these names: Atorvastatin Impurity 68, Atorvastatin impurity 116. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (CAS 2165770-84-1) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid. InChIKey: BNGGGQKEDABCQY-YUMQZZPRSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
| InChIKey | BNGGGQKEDABCQY-YUMQZZPRSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CC(=O)O)CCN)C |
Computed by PubChem (NCBI)