CAS 1259978-34-1 is the registry number for 2,3,4-Trifluoro-dl-phenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-amino-3-(2,3,4-trifluorophenyl)propanoic acid (CAS 1259978-34-1) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2-amino-3-(2,3,4-trifluorophenyl)propanoic acid. InChIKey: FGKZSVVTLDUTMM-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2-amino-3-(2,3,4-trifluorophenyl)propanoic acid |
| InChIKey | FGKZSVVTLDUTMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC(C(=O)O)N)F)F)F |
Computed by PubChem (NCBI)