CAS 873429-58-4 appears in our catalog under these names: (S)-2-Amino-3-(2,3,4-trifluorophenyl)propanoic acid, 95%, 95%, (S)-2-Amino-3-(2,3,4-trifluorophenyl)propanoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-3-(2,3,4-trifluorophenyl)propanoic acid (CAS 873429-58-4) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: (2S)-2-amino-3-(2,3,4-trifluorophenyl)propanoic acid. InChIKey: FGKZSVVTLDUTMM-LURJTMIESA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,3,4-trifluorophenyl)propanoic acid |
| InChIKey | FGKZSVVTLDUTMM-LURJTMIESA-N |
| SMILES | C1=CC(=C(C(=C1C[C@@H](C(=O)O)N)F)F)F |
Computed by PubChem (NCBI)