CAS 1259986-44-1 is the registry number for 3-(Biphenyl-3-yl)-2-(Boc-amino)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylphenyl)propanoic acid (CAS 1259986-44-1) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylphenyl)propanoic acid. InChIKey: JMEFJZPUOYOJOM-UHFFFAOYSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylphenyl)propanoic acid |
| InChIKey | JMEFJZPUOYOJOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)