CAS 126007-98-5 is the registry number for 3-Chloro-4-methoxybenzene-1-carboximidamide hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-chloro-4-methoxybenzenecarboximidamide;hydrochloride (CAS 126007-98-5) is a chemical compound with the molecular formula C8H10Cl2N2O and a molecular weight of 221.08 g/mol. IUPAC name: 3-chloro-4-methoxybenzenecarboximidamide;hydrochloride. InChIKey: SYVZCZVIURXKBE-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2O |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 3-chloro-4-methoxybenzenecarboximidamide;hydrochloride |
| InChIKey | SYVZCZVIURXKBE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=N)N)Cl.Cl |
Computed by PubChem (NCBI)