CAS 1260228-03-2 is the registry number for N'-((1H-Indol-5-yl)methylene)-[1,1'-biphenyl]-4-carbohydrazide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(1H-indol-5-ylmethylideneamino)-4-phenylbenzamide (CAS 1260228-03-2) is a chemical compound with the molecular formula C22H17N3O and a molecular weight of 339.4 g/mol. IUPAC name: N-(1H-indol-5-ylmethylideneamino)-4-phenylbenzamide. InChIKey: SKSPJPSAICDDGY-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | N-(1H-indol-5-ylmethylideneamino)-4-phenylbenzamide |
| InChIKey | SKSPJPSAICDDGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NN=CC3=CC4=C(C=C3)NC=C4 |
Computed by PubChem (NCBI)