CAS 2828438-15-7 is the registry number for (S)-4-Benzyl-2-(1,10-phenanthrolin-2-yl)-4,5-dihydrooxazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4S)-4-benzyl-2-(1,10-phenanthrolin-2-yl)-4,5-dihydro-1,3-oxazole (CAS 2828438-15-7) is a chemical compound with the molecular formula C22H17N3O and a molecular weight of 339.4 g/mol. IUPAC name: (4S)-4-benzyl-2-(1,10-phenanthrolin-2-yl)-4,5-dihydro-1,3-oxazole. InChIKey: VGABFPRIPVBVHX-SFHVURJKSA-N.
| Molecular formula | C22H17N3O |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (4S)-4-benzyl-2-(1,10-phenanthrolin-2-yl)-4,5-dihydro-1,3-oxazole |
| InChIKey | VGABFPRIPVBVHX-SFHVURJKSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=NC3=C(C=CC4=C3N=CC=C4)C=C2)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)