CAS 351327-25-8 appears in our catalog under these names: 2-Biphenyl-4-yl-quinoline-4-carboxylic acid hydrazide, 95%, 2-(4-Phenylphenyl)quinoline-4-carbohydrazide, 95%, 2-(4-Phenylphenyl)quinoline-4-carbohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(4-phenylphenyl)quinoline-4-carbohydrazide (CAS 351327-25-8) is a chemical compound with the molecular formula C22H17N3O and a molecular weight of 339.4 g/mol. IUPAC name: 2-(4-phenylphenyl)quinoline-4-carbohydrazide. InChIKey: OZCBXZHQJVDKKI-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-(4-phenylphenyl)quinoline-4-carbohydrazide |
| InChIKey | OZCBXZHQJVDKKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC4=CC=CC=C4C(=C3)C(=O)NN |
Computed by PubChem (NCBI)