CAS 23449-07-2 is the registry number for 2-(4-Methoxyphenyl)-4,6-diphenyl-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methoxyphenyl)-4,6-diphenyl-1,3,5-triazine (CAS 23449-07-2) is a chemical compound with the molecular formula C22H17N3O and a molecular weight of 339.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: YRRPMAVQIDXZQN-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | YRRPMAVQIDXZQN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)