Products 1260384-52-8
CAS 1260384-52-8 is the registry number for methyl6-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 6-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS 1260384-52-8) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 6-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate. InChIKey: VSYWXEKQCMEHEI-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 6-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| InChIKey | VSYWXEKQCMEHEI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C2C(=C1)C=CN2)F |
Computed by PubChem (NCBI)