Products 1260387-09-4
CAS 1260387-09-4 appears in our catalog under these names: 4-Fluoro-1h-pyrrolo[2,3-b]pyridine-5-carboxylic acid, 95%, 4-Fluoro-1H-pyrrolo(2,3-b)pyridine-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 25g.
4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid (CAS 1260387-09-4) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid. InChIKey: MOFQOEDBMKIYBZ-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid |
| InChIKey | MOFQOEDBMKIYBZ-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)F)C(=O)O |
Computed by PubChem (NCBI)