Products 1197193-14-8
CAS 1197193-14-8 appears in our catalog under these names: 2-Fluoro-4-pyrrolidinobenzoic acid, 97%, 2–Fluoro–4–pyrrolidinobenzoic Acid, 2-Fluoro-4-pyrrolidinobenzoic Acid, >97%, >97%, 2-Fluoro-4-pyrrolidinobenzoic acid. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100g, 250mg.
2-fluoro-4-pyrrolidin-1-ylbenzoic acid (CAS 1197193-14-8) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: 2-fluoro-4-pyrrolidin-1-ylbenzoic acid. InChIKey: PMGPRXDYEZSZHN-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 2-fluoro-4-pyrrolidin-1-ylbenzoic acid |
| InChIKey | PMGPRXDYEZSZHN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)