CAS 1260590-39-3 is the registry number for (R)(3–Chloro–phenyl)–((9H–fluoren–9–ylmethoxycarbonylamino))–aceticacid. Offered by: GLPBio. Available pack sizes: 1g.
(2R)-2-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1260590-39-3) is a chemical compound with the molecular formula C23H18ClNO4 and a molecular weight of 407.8 g/mol. IUPAC name: (2R)-2-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: IWNXWBFVGWGSRR-OAQYLSRUSA-N.
| Molecular formula | C23H18ClNO4 |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | (2R)-2-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | IWNXWBFVGWGSRR-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](C4=CC(=CC=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)