CAS 339208-90-1 appears in our catalog under these names: 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(3-chlorophenyl)acetic acid, 97%, 2-(3-Chlorophenyl)-2-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 339208-90-1) is a chemical compound with the molecular formula C23H18ClNO4 and a molecular weight of 407.8 g/mol. IUPAC name: 2-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: IWNXWBFVGWGSRR-UHFFFAOYSA-N.
| Molecular formula | C23H18ClNO4 |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | IWNXWBFVGWGSRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C4=CC(=CC=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)