CAS 1260603-56-2 appears in our catalog under these names: (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(4-chlorophenyl)acetic acid, ≥98%, ≥98%, Fmoc-D-Phg(4-Cl)-OH, 95% (contains~4.0% water). Offered by: Chemat, Ambeed. Available pack sizes: 100g, 1g, 5g, 25g.
(2R)-2-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1260603-56-2) is a chemical compound with the molecular formula C23H18ClNO4 and a molecular weight of 407.8 g/mol. IUPAC name: (2R)-2-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: QHPCQNPEZKEZGX-OAQYLSRUSA-N.
| Molecular formula | C23H18ClNO4 |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | (2R)-2-(4-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | QHPCQNPEZKEZGX-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](C4=CC=C(C=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)