CAS 1260608-83-0 appears in our catalog under these names: (2S)-2-(2-chlorophenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetic acid, 98%, 98%, (S)-Fmoc-Phg(2-Cl)-OH, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(2S)-2-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1260608-83-0) is a chemical compound with the molecular formula C23H18ClNO4 and a molecular weight of 407.8 g/mol. IUPAC name: (2S)-2-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: JXDNNHWVILUHSO-NRFANRHFSA-N.
| Molecular formula | C23H18ClNO4 |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | (2S)-2-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | JXDNNHWVILUHSO-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](C4=CC=CC=C4Cl)C(=O)O |
Computed by PubChem (NCBI)