CAS 1260590-83-7 appears in our catalog under these names: (R)-a-(Fmoc-amino)-4-fluoro-benzenebutanoic acid, 95%, (R)-a-(Fmoc-amino)-4-fluoro-benzenebutanoic acid, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-fluorophenyl)butanoic acid (CAS 1260590-83-7) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-fluorophenyl)butanoic acid. InChIKey: KUXCZWSGUCCUBR-HSZRJFAPSA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-fluorophenyl)butanoic acid |
| InChIKey | KUXCZWSGUCCUBR-HSZRJFAPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC4=CC=C(C=C4)F)C(=O)O |
Computed by PubChem (NCBI)