CAS 1260608-85-2 appears in our catalog under these names: N–Fmoc–(S)–4–fluorohomophenylalanine, Fmoc-HoPhe(4-F)-OH 97%, N-Fmoc-(S)-4-fluorohomophenylalanine, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-fluorophenyl)butanoic acid (CAS 1260608-85-2) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-fluorophenyl)butanoic acid. InChIKey: KUXCZWSGUCCUBR-QHCPKHFHSA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-fluorophenyl)butanoic acid |
| InChIKey | KUXCZWSGUCCUBR-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=CC=C(C=C4)F)C(=O)O |
Computed by PubChem (NCBI)