CAS 1260592-42-4 is the registry number for 2,4-Dimethoxy-D-homophenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-amino-4-(2,4-dimethoxyphenyl)butanoic acid (CAS 1260592-42-4) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: (2R)-2-amino-4-(2,4-dimethoxyphenyl)butanoic acid. InChIKey: VOUNXUPUQUYGLI-SNVBAGLBSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | (2R)-2-amino-4-(2,4-dimethoxyphenyl)butanoic acid |
| InChIKey | VOUNXUPUQUYGLI-SNVBAGLBSA-N |
| SMILES | COC1=CC(=C(C=C1)CC[C@H](C(=O)O)N)OC |
Computed by PubChem (NCBI)