CAS 1260596-66-4 is the registry number for Fmoc-D-Phe(2,5-dicl)-OH, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 5g.
(2R)-3-(2,5-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1260596-66-4) is a chemical compound with the molecular formula C24H19Cl2NO4 and a molecular weight of 456.3 g/mol. IUPAC name: (2R)-3-(2,5-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: VKWVAMUOEUIASD-JOCHJYFZSA-N.
| Molecular formula | C24H19Cl2NO4 |
|---|---|
| Molecular weight | 456.3 g/mol |
| IUPAC name | (2R)-3-(2,5-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | VKWVAMUOEUIASD-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=C(C=CC(=C4)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)