CAS 1260606-18-5 appears in our catalog under these names: (2S,3S)-1-(tert-Butoxycarbonyl)-2-methylpiperidine-3-carboxylic acid, 95%, (2S,3S)-1-(tert-Butoxycarbonyl)-2-methylpiperidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2S,3S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 1260606-18-5) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S,3S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: TZNCDXAIDIETKV-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S,3S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | TZNCDXAIDIETKV-IUCAKERBSA-N |
| SMILES | C[C@H]1[C@H](CCCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)