CAS 1808650-03-4 is the registry number for 1,3-Piperidinedicarboxylic acid, 2-methyl-, 1-(1,1-dimethylethyl) ester, (2r,3r)-rel-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 1808650-03-4) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2R,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: TZNCDXAIDIETKV-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2R,3R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | TZNCDXAIDIETKV-RKDXNWHRSA-N |
| SMILES | C[C@@H]1[C@@H](CCCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)