CAS 1260616-67-8 appears in our catalog under these names: (R)-3-Amino-2-(4-methoxybenzyl)propanoic acid, 98%, (R)-H-β2-HoTyr(Me)-OH, 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g.
(2R)-2-(aminomethyl)-3-(4-methoxyphenyl)propanoic acid (CAS 1260616-67-8) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2R)-2-(aminomethyl)-3-(4-methoxyphenyl)propanoic acid. InChIKey: DFKAWZDMKJDTFC-SECBINFHSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2R)-2-(aminomethyl)-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | DFKAWZDMKJDTFC-SECBINFHSA-N |
| SMILES | COC1=CC=C(C=C1)C[C@H](CN)C(=O)O |
Computed by PubChem (NCBI)