CAS 1260640-98-9 appears in our catalog under these names: 4-Bromo-6,7-dimethoxyquinazoline, 98+%, 4-Bromo-6,7-dimethoxyquinazoline, 95%+, 95%+. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
4-bromo-6,7-dimethoxyquinazoline (CAS 1260640-98-9) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 4-bromo-6,7-dimethoxyquinazoline. InChIKey: IMLLNCXBVIJJOK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 4-bromo-6,7-dimethoxyquinazoline |
| InChIKey | IMLLNCXBVIJJOK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)Br)OC |
Computed by PubChem (NCBI)