CAS 1260645-80-4 appears in our catalog under these names: 3-Fluoro-4-(piperidin-3-yl)pyridine, 97%, 3–Fluoro–4–(piperidin–3–yl)pyridine dihydrochloride, 3-Fluoro-4-(piperidin-3-yl)pyridine dihydrochloride, 95%, 3-Fluoro-4-(piperidin-3-yl)pyridine dihydrochloride, ≥95%, ≥95%. Offered by: Chemat Brand, GLPBio, Combi-blocks, Chemat. Available pack sizes: on request, 100mg, 25mg, 5mg.
3-fluoro-4-piperidin-3-ylpyridine;dihydrochloride (CAS 1260645-80-4) is a chemical compound with the molecular formula C10H15Cl2FN2 and a molecular weight of 253.14 g/mol. IUPAC name: 3-fluoro-4-piperidin-3-ylpyridine;dihydrochloride. InChIKey: ZNBYPLGGAITAKE-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2FN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 3-fluoro-4-piperidin-3-ylpyridine;dihydrochloride |
| InChIKey | ZNBYPLGGAITAKE-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=C(C=NC=C2)F.Cl.Cl |
Computed by PubChem (NCBI)