CAS 76835-10-4 appears in our catalog under these names: 1–(3–Fluorophenyl)piperazine (hydrochloride), 1-(3-Fluorophenyl)piperazine (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 50 mg, 25 mg, 100 mg, 10 mg.
1-(3-fluorophenyl)piperazine;dihydrochloride (CAS 76835-10-4) is a chemical compound with the molecular formula C10H15Cl2FN2 and a molecular weight of 253.14 g/mol. IUPAC name: 1-(3-fluorophenyl)piperazine;dihydrochloride. InChIKey: GSPXXVQXENGQIQ-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2FN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 1-(3-fluorophenyl)piperazine;dihydrochloride |
| InChIKey | GSPXXVQXENGQIQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC=C2)F.Cl.Cl |
Computed by PubChem (NCBI)