CAS 2301169-15-1 is the registry number for 3-Fluoro-5-(piperidin-3-yl)pyridine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-5-piperidin-3-ylpyridine;dihydrochloride (CAS 2301169-15-1) is a chemical compound with the molecular formula C10H15Cl2FN2 and a molecular weight of 253.14 g/mol. IUPAC name: 3-fluoro-5-piperidin-3-ylpyridine;dihydrochloride. InChIKey: VOVNBTGBXGKPDM-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2FN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 3-fluoro-5-piperidin-3-ylpyridine;dihydrochloride |
| InChIKey | VOVNBTGBXGKPDM-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CC(=CN=C2)F.Cl.Cl |
Computed by PubChem (NCBI)