Products 2593177-96-7
CAS 2593177-96-7 is the registry number for (7-Fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(7-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine;dihydrochloride (CAS 2593177-96-7) is a chemical compound with the molecular formula C10H15Cl2FN2 and a molecular weight of 253.14 g/mol. IUPAC name: (7-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine;dihydrochloride. InChIKey: NEAHVCLSYLZGQK-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2FN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | (7-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine;dihydrochloride |
| InChIKey | NEAHVCLSYLZGQK-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C=CC(=C2)F)CN.Cl.Cl |
Computed by PubChem (NCBI)