CAS 1260657-84-8 appears in our catalog under these names: 4-Amino-3-methoxy-5-nitrobenzoic acid, 95%, 4-Amino-3-methoxy-5-nitrobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-amino-3-methoxy-5-nitrobenzoic acid (CAS 1260657-84-8) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: 4-amino-3-methoxy-5-nitrobenzoic acid. InChIKey: IJWXHFVCOCMQAP-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | 4-amino-3-methoxy-5-nitrobenzoic acid |
| InChIKey | IJWXHFVCOCMQAP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1N)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)