CAS 156896-54-7 is the registry number for Ethyl 2-hydroxy-5-nitronicotinate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 5-nitro-2-oxo-1H-pyridine-3-carboxylate (CAS 156896-54-7) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: ethyl 5-nitro-2-oxo-1H-pyridine-3-carboxylate. InChIKey: FRPVIVOIVRFMPE-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | ethyl 5-nitro-2-oxo-1H-pyridine-3-carboxylate |
| InChIKey | FRPVIVOIVRFMPE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CNC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)