CAS 4836-69-5 appears in our catalog under these names: 2-(2,4-Dinitrophenyl)ethanol, 98%, 2,4-Dinitrophenylethylalcohol, 95%, 95%, 2-(2,4-DINITROPHENYL)ETHANOL, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 250mg, 100mg.
2-(2,4-dinitrophenyl)ethanol (CAS 4836-69-5) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: 2-(2,4-dinitrophenyl)ethanol. InChIKey: AONMTYOVKUOHQP-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | 2-(2,4-dinitrophenyl)ethanol |
| InChIKey | AONMTYOVKUOHQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CCO |
Computed by PubChem (NCBI)