CAS 36131-48-3 appears in our catalog under these names: Ethyl 5-formyl-3-nitro-1h-pyrrole-2-carboxylate, 95%, 1H-PYrrole-2-carboxylic acid, 5-formyl-3-nitro-, ethyl ester, 95%, Ethyl 5–formyl–3–nitro–1H–pyrrole–2–carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 5-formyl-3-nitro-1H-pyrrole-2-carboxylate (CAS 36131-48-3) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: ethyl 5-formyl-3-nitro-1H-pyrrole-2-carboxylate. InChIKey: GLXXCDACRPXMQK-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | ethyl 5-formyl-3-nitro-1H-pyrrole-2-carboxylate |
| InChIKey | GLXXCDACRPXMQK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(N1)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)