CAS 89977-22-0 appears in our catalog under these names: 2-Hydroxy-4,6-dimethyl-5-nitropyridine-3-carboxylic acid, 95%, 4,6-Dimethyl-5-nitro-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4,6-dimethyl-5-nitro-2-oxo-1H-pyridine-3-carboxylic acid (CAS 89977-22-0) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: 4,6-dimethyl-5-nitro-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: GJSAGPKAERRLKB-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | 4,6-dimethyl-5-nitro-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | GJSAGPKAERRLKB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=C1[N+](=O)[O-])C)C(=O)O |
Computed by PubChem (NCBI)