CAS 1260659-18-4 appears in our catalog under these names: 2-(1-(2,2,2-Trifluoroethyl)-1H-pyrazol-3-yl)acetic acid, 97%, 2-(1-(2,2,2-Trifluoroethyl)-1H-pyrazol-3-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]acetic acid (CAS 1260659-18-4) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 2-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]acetic acid. InChIKey: UNFZKRKCIQJNKV-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 2-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]acetic acid |
| InChIKey | UNFZKRKCIQJNKV-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1CC(=O)O)CC(F)(F)F |
Computed by PubChem (NCBI)