Products 1260659-24-2

CAS 1260659-24-2 is the registry number for Methyl 5-(chlorosulfonyl)-1-ethyl-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-chlorosulfonyl-1-ethylpyrazole-3-carboxylate (CAS 1260659-24-2) is a chemical compound with the molecular formula C7H9ClN2O4S and a molecular weight of 252.68 g/mol. IUPAC name: methyl 5-chlorosulfonyl-1-ethylpyrazole-3-carboxylate. InChIKey: YIPZCIVVMXJKGO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClN2O4S
Molecular weight252.68 g/mol
IUPAC namemethyl 5-chlorosulfonyl-1-ethylpyrazole-3-carboxylate
InChIKeyYIPZCIVVMXJKGO-UHFFFAOYSA-N
SMILESCCN1C(=CC(=N1)C(=O)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)