CAS 1299471-28-5 appears in our catalog under these names: Ethyl 5-(chlorosulfonyl)-3-methyl-1h-pyrazole-4-carboxylate, 95%, ethyl 5-(chlorosulfonyl)-3-methyl-1H-pyrazole-4-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
Ethyl 3-chlorosulfonyl-5-methyl-1H-pyrazole-4-carboxylate (CAS 1299471-28-5) is a chemical compound with the molecular formula C7H9ClN2O4S and a molecular weight of 252.68 g/mol. IUPAC name: ethyl 3-chlorosulfonyl-5-methyl-1H-pyrazole-4-carboxylate. InChIKey: YBVUJZKYBUCSOY-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O4S |
|---|---|
| Molecular weight | 252.68 g/mol |
| IUPAC name | ethyl 3-chlorosulfonyl-5-methyl-1H-pyrazole-4-carboxylate |
| InChIKey | YBVUJZKYBUCSOY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NN=C1S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)