Products 926199-52-2

CAS 926199-52-2 appears in our catalog under these names: 1,3,6-Trimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl chloride, 95%, 1,3,6-Trimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonyl chloride (CAS 926199-52-2) is a chemical compound with the molecular formula C7H9ClN2O4S and a molecular weight of 252.68 g/mol. IUPAC name: 1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonyl chloride. InChIKey: GZEPSAUGHMMJCR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClN2O4S
Molecular weight252.68 g/mol
IUPAC name1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonyl chloride
InChIKeyGZEPSAUGHMMJCR-UHFFFAOYSA-N
SMILESCC1=C(C(=O)N(C(=O)N1C)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)