CAS 2059948-91-1 is the registry number for 4-Amino-2-sulfamoylbenzoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-2-sulfamoylbenzoic acid;hydrochloride (CAS 2059948-91-1) is a chemical compound with the molecular formula C7H9ClN2O4S and a molecular weight of 252.68 g/mol. IUPAC name: 4-amino-2-sulfamoylbenzoic acid;hydrochloride. InChIKey: YORSENFSTQQVCD-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O4S |
|---|---|
| Molecular weight | 252.68 g/mol |
| IUPAC name | 4-amino-2-sulfamoylbenzoic acid;hydrochloride |
| InChIKey | YORSENFSTQQVCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)S(=O)(=O)N)C(=O)O.Cl |
Computed by PubChem (NCBI)