Products 2059948-91-1

CAS 2059948-91-1 is the registry number for 4-Amino-2-sulfamoylbenzoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-amino-2-sulfamoylbenzoic acid;hydrochloride (CAS 2059948-91-1) is a chemical compound with the molecular formula C7H9ClN2O4S and a molecular weight of 252.68 g/mol. IUPAC name: 4-amino-2-sulfamoylbenzoic acid;hydrochloride. InChIKey: YORSENFSTQQVCD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClN2O4S
Molecular weight252.68 g/mol
IUPAC name4-amino-2-sulfamoylbenzoic acid;hydrochloride
InChIKeyYORSENFSTQQVCD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N)S(=O)(=O)N)C(=O)O.Cl

Computed by PubChem (NCBI)