CAS 1260663-94-2 appears in our catalog under these names: 5–BROMO–2,7–NAPHTHYRIDIN–1(2H)–ONE, 5-Bromo-1,2-dihydro-2,7-naphthyridin-1-one. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
5-bromo-2H-2,7-naphthyridin-1-one (CAS 1260663-94-2) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-2H-2,7-naphthyridin-1-one. InChIKey: NABGQOLVZFQDJS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-2H-2,7-naphthyridin-1-one |
| InChIKey | NABGQOLVZFQDJS-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=CN=CC(=C21)Br |
Computed by PubChem (NCBI)