CAS 1260665-60-8 appears in our catalog under these names: 3-Bromo-1,6-naphthyridin-5(6H)-one, 3-Bromo-1,6-naphthyridin-5(6H)-one, 98%, 98%, 3-BROMO-1,6-NAPHTHYRIDIN-5(6H)-ONE, 98%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g, 2.5g.
3-bromo-6H-1,6-naphthyridin-5-one (CAS 1260665-60-8) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 3-bromo-6H-1,6-naphthyridin-5-one. InChIKey: DSLVZFMKYFFBMX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 3-bromo-6H-1,6-naphthyridin-5-one |
| InChIKey | DSLVZFMKYFFBMX-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=C1N=CC(=C2)Br |
Computed by PubChem (NCBI)