Products 1260672-03-4
CAS 1260672-03-4 appears in our catalog under these names: 5-Phenylmorpholin-3-one, 95-<97%, 5-Phenylmorpholin-3-one, 5-Phenylmorpholin-3-one 95%, 5-Phenylmorpholin-3-one, 95%, 95%, 5-Phenylmorpholin-3-one, 98%. Offered by: Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 2,5g, 100mg.
5-phenylmorpholin-3-one (CAS 1260672-03-4) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 5-phenylmorpholin-3-one. InChIKey: GXDVCRCMLDJGAS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5-phenylmorpholin-3-one |
| InChIKey | GXDVCRCMLDJGAS-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)CO1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)